CAS 477587-17-0

2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carbonyl chloride

Description:

2,3-Dihydrothieno[3,4-b][1,4]dioxine-5-carbonyl chloride is a heterocyclic organic compound characterized by its unique bicyclic structure that incorporates both a thieno and dioxine moiety. This compound features a carbonyl chloride functional group, which makes it reactive and suitable for various chemical transformations. It is typically a colorless to pale yellow solid, and its molecular structure contributes to its potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The presence of the carbonyl chloride group indicates that it can participate in nucleophilic substitution reactions, making it a versatile intermediate in synthetic chemistry. Additionally, the compound may exhibit specific physical properties such as solubility in organic solvents, which can vary based on the solvent's polarity. Safety considerations are essential when handling this compound due to the reactivity of the carbonyl chloride group, which can release hydrochloric acid upon hydrolysis. Overall, 2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carbonyl chloride is a valuable compound in the field of synthetic organic chemistry.

Formula: C₇H₅ClO₃S

InChI: InChI=1/C7H5ClO3S/c8-7(9)6-5-4(3-12-6)10-1-2-11-5/h3H,1-2H2

SMILES: C1COc2c(csc2C(=O)Cl)O1

Synonyms:

• 2,3-Dihydrothieno[3,4-B][1,4]Dioxin-5-Carbonyl Chloride

2,3-Dihydrothieno[3,4-b][1,4]dioxin-5-carbonyl chloride

CAS: 477587-17-0

2,3-Dihydrothieno[3,4-b][1,4]dioxin-5-carbonyl chloride

Purity: 90%

Molecular weight: 204.63g/mol

Ref: 54-OR9795