CymitQuimica logo

CAS 477709-24-3

:

Ethyl 5-[2-[2-(dimethylamino)-2-oxoacetyl]-1H-pyrrol-1-yl]-1-phenyl-1H-pyrazole-4-carboxylate

Description:
Ethyl 5-[2-[2-(dimethylamino)-2-oxoacetyl]-1H-pyrrol-1-yl]-1-phenyl-1H-pyrazole-4-carboxylate, with CAS number 477709-24-3, is a complex organic compound characterized by its multi-functional structure. It features a pyrazole ring, which is known for its biological activity, and a pyrrole moiety that contributes to its potential pharmacological properties. The presence of a dimethylamino group suggests that the compound may exhibit basic properties, potentially influencing its solubility and reactivity. The ethyl ester functional group indicates that it may undergo hydrolysis, which can affect its stability and bioavailability. This compound is likely to be of interest in medicinal chemistry due to its potential applications in drug development, particularly in targeting specific biological pathways. Its synthesis and characterization would involve standard organic chemistry techniques, and its properties can be further explored through various analytical methods such as NMR, mass spectrometry, and chromatography. Overall, this compound exemplifies the complexity and diversity of organic molecules in pharmaceutical research.
Formula:C20H20N4O4
InChI:InChI=1S/C20H20N4O4/c1-4-28-20(27)15-13-21-24(14-9-6-5-7-10-14)18(15)23-12-8-11-16(23)17(25)19(26)22(2)3/h5-13H,4H2,1-3H3
InChI key:InChIKey=NTQYNZOGMDOXLG-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C(N(N=C1)C2=CC=CC=C2)N3C(C(C(N(C)C)=O)=O)=CC=C3
Synonyms:
  • 1H-Pyrazole-4-carboxylic acid, 5-[2-[(dimethylamino)oxoacetyl]-1H-pyrrol-1-yl]-1-phenyl-, ethyl ester
  • 1H-Pyrazole-4-carboxylic acid, 5-[2-[2-(dimethylamino)-2-oxoacetyl]-1H-pyrrol-1-yl]-1-phenyl-, ethyl ester
  • Ethyl 5-[2-[2-(dimethylamino)-2-oxoacetyl]-1H-pyrrol-1-yl]-1-phenyl-1H-pyrazole-4-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.