CymitQuimica logo

CAS 477710-47-7

:

Ethyl 1-[5-[(2,6-difluorobenzoyl)amino]-2-pyridinyl]-3,5-dimethyl-1H-pyrazole-4-carboxylate

Description:
Ethyl 1-[5-[(2,6-difluorobenzoyl)amino]-2-pyridinyl]-3,5-dimethyl-1H-pyrazole-4-carboxylate is a chemical compound characterized by its complex structure, which includes a pyrazole ring, a pyridine moiety, and a difluorobenzoyl group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the difluorobenzoyl group may enhance its lipophilicity and influence its interaction with biological targets. The ethyl ester functional group suggests that it may undergo hydrolysis to release the corresponding carboxylic acid, which could be relevant for its metabolic pathways. Additionally, the presence of multiple functional groups indicates potential for diverse reactivity and applications in medicinal chemistry, particularly in the development of novel therapeutic agents. Overall, this compound's unique structural features contribute to its potential utility in various chemical and biological contexts.
Formula:C20H18F2N4O3
InChI:InChI=1S/C20H18F2N4O3/c1-4-29-20(28)17-11(2)25-26(12(17)3)16-9-8-13(10-23-16)24-19(27)18-14(21)6-5-7-15(18)22/h5-10H,4H2,1-3H3,(H,24,27)
InChI key:InChIKey=AQTMKFNVSBXZSY-UHFFFAOYSA-N
SMILES:CC=1N(N=C(C)C1C(OCC)=O)C2=CC=C(NC(=O)C3=C(F)C=CC=C3F)C=N2
Synonyms:
  • 1H-Pyrazole-4-carboxylic acid, 1-[5-[(2,6-difluorobenzoyl)amino]-2-pyridinyl]-3,5-dimethyl-, ethyl ester
  • Ethyl 1-[5-[(2,6-difluorobenzoyl)amino]-2-pyridinyl]-3,5-dimethyl-1H-pyrazole-4-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.