
CAS 477710-52-4
:1-(Phenylmethyl)-2-(1H-pyrazol-3-yl)-1H-benzimidazole
Description:
1-(Phenylmethyl)-2-(1H-pyrazol-3-yl)-1H-benzimidazole, with the CAS number 477710-52-4, is a chemical compound characterized by its complex structure, which includes a benzimidazole core fused with a phenylmethyl group and a pyrazole moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry. The presence of the benzimidazole ring suggests possible interactions with biological targets, as this structural motif is often associated with various pharmacological activities, including anti-cancer and anti-inflammatory effects. The pyrazole group may also contribute to its reactivity and biological profile. Additionally, the compound's molecular weight, melting point, and specific reactivity can vary based on its purity and the conditions under which it is synthesized. Overall, this compound represents a class of heterocyclic compounds that are valuable in drug discovery and development due to their diverse biological activities.
Formula:C17H14N4
InChI:InChI=1S/C17H14N4/c1-2-6-13(7-3-1)12-21-16-9-5-4-8-14(16)19-17(21)15-10-11-18-20-15/h1-11H,12H2,(H,18,20)
InChI key:InChIKey=MCDFRQAMFUEDSA-UHFFFAOYSA-N
SMILES:C(N1C(=NC=2C1=CC=CC2)C=3C=CNN3)C4=CC=CC=C4
Synonyms:- 1-(Phenylmethyl)-2-(1H-pyrazol-3-yl)-1H-benzimidazole
- 1H-Benzimidazole, 1-(phenylmethyl)-2-(1H-pyrazol-3-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.