CAS 477712-41-7

5-(4-Chlorophenyl)-N-(2,5-dimethoxyphenyl)-1-phenyl-1H-pyrazole-3-carboxamide

Description:

5-(4-Chlorophenyl)-N-(2,5-dimethoxyphenyl)-1-phenyl-1H-pyrazole-3-carboxamide, with the CAS number 477712-41-7, is a synthetic organic compound characterized by its complex molecular structure, which includes a pyrazole core substituted with various aromatic groups. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the chlorophenyl and dimethoxyphenyl groups suggests that it may interact with biological targets, potentially influencing its pharmacological profile. The carboxamide functional group can enhance hydrogen bonding capabilities, which may affect its binding affinity to receptors or enzymes. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the substituents on the pyrazole ring. Overall, this compound represents a class of pyrazole derivatives that may have applications in medicinal chemistry, particularly in the development of new therapeutic agents.

Formula: C₂₄H₂₀ClN₃O₃

InChI: InChI=1S/C24H20ClN3O3/c1-30-19-12-13-23(31-2)20(14-19)26-24(29)21-15-22(16-8-10-17(25)11-9-16)28(27-21)18-6-4-3-5-7-18/h3-15H,1-2H3,(H,26,29)

InChI key: InChIKey=QITADYWDSARWAF-UHFFFAOYSA-N

SMILES: C(NC1=C(OC)C=CC(OC)=C1)(=O)C=2C=C(N(N2)C3=CC=CC=C3)C4=CC=C(Cl)C=C4

Synonyms:

• 1H-Pyrazole-3-carboxamide, 5-(4-chlorophenyl)-N-(2,5-dimethoxyphenyl)-1-phenyl-
• 5-(4-Chlorophenyl)-N-(2,5-dimethoxyphenyl)-1-phenyl-1H-pyrazole-3-carboxamide