CAS 477712-83-7

Ethyl 1-[5-[[[(3-fluorophenyl)amino]carbonyl]amino]-2-pyridinyl]-3,5-dimethyl-1H-pyrazole-4-carboxylate

Description:

Ethyl 1-[5-[[[(3-fluorophenyl)amino]carbonyl]amino]-2-pyridinyl]-3,5-dimethyl-1H-pyrazole-4-carboxylate, with CAS number 477712-83-7, is a chemical compound characterized by its complex structure, which includes a pyrazole ring, a pyridine moiety, and an ethyl ester functional group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the fluorophenyl and pyridinyl groups suggests possible interactions with biological targets, which may contribute to its pharmacological effects. Additionally, the compound's structure indicates it may participate in hydrogen bonding and other intermolecular interactions, influencing its reactivity and stability. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be evaluated for its efficacy in various biological assays. Overall, this compound represents a class of molecules that could have applications in drug development, particularly in the context of targeting specific biological pathways.

Formula: C₂₀H₂₀FN₅O₃

InChI: InChI=1S/C20H20FN5O3/c1-4-29-19(27)18-12(2)25-26(13(18)3)17-9-8-16(11-22-17)24-20(28)23-15-7-5-6-14(21)10-15/h5-11H,4H2,1-3H3,(H2,23,24,28)

InChI key: InChIKey=WEUFQYMLUFCUQX-UHFFFAOYSA-N

SMILES: CC=1N(N=C(C)C1C(OCC)=O)C2=CC=C(NC(NC3=CC(F)=CC=C3)=O)C=N2

Synonyms:

• Ethyl 1-[5-[[[(3-fluorophenyl)amino]carbonyl]amino]-2-pyridinyl]-3,5-dimethyl-1H-pyrazole-4-carboxylate
• 1H-Pyrazole-4-carboxylic acid, 1-[5-[[[(3-fluorophenyl)amino]carbonyl]amino]-2-pyridinyl]-3,5-dimethyl-, ethyl ester