CAS 477725-46-5

1,2-Diethyl 3,3-dimethyl-4-(1-pyrrolidinyl)-1,2-cyclobutanedicarboxylate

Description:

1,2-Diethyl 3,3-dimethyl-4-(1-pyrrolidinyl)-1,2-cyclobutanedicarboxylate is a synthetic organic compound characterized by its unique cyclobutane structure, which features two ethyl groups and a pyrrolidine moiety. This compound belongs to the class of diesters, specifically dicarboxylates, indicating the presence of two carboxylate functional groups within its structure. The presence of the pyrrolidine ring suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological systems. The compound is likely to exhibit moderate to high lipophilicity, influencing its solubility and permeability properties. Additionally, the presence of multiple functional groups may contribute to its reactivity and potential for forming various derivatives. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact of this compound would need to be assessed through further studies. Overall, this compound represents a complex structure with potential applications in various fields, including drug development and organic synthesis.

Formula: C₁₆H₂₇NO₄

InChI: InChI=1S/C16H27NO4/c1-5-20-14(18)11-12(15(19)21-6-2)16(3,4)13(11)17-9-7-8-10-17/h11-13H,5-10H2,1-4H3

InChI key: InChIKey=RJAIFMNTFDYYIO-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1C(C(C)(C)C1C(OCC)=O)N2CCCC2

Synonyms:

• 1,2-Cyclobutanedicarboxylic acid, 3,3-dimethyl-4-(1-pyrrolidinyl)-, 1,2-diethyl ester
• 1,2-Diethyl 3,3-dimethyl-4-(1-pyrrolidinyl)-1,2-cyclobutanedicarboxylate
• 1,2-Cyclobutanedicarboxylic acid, 3,3-dimethyl-4-(1-pyrrolidinyl)-, diethyl ester