CAS 477762-53-1
:(2R)-3-[(4-Bromophenyl)thio]-1,1,1-trifluoro-2-propanol
Description:
(2R)-3-[(4-Bromophenyl)thio]-1,1,1-trifluoro-2-propanol is a chemical compound characterized by its unique structural features, including a trifluoromethyl group and a bromophenyl thioether moiety. The presence of the trifluoromethyl group imparts significant polarity and can influence the compound's reactivity and solubility in various solvents. The bromophenyl group contributes to the compound's overall hydrophobic character and can also affect its electronic properties, making it potentially useful in various applications, including pharmaceuticals and agrochemicals. The thioether linkage introduces sulfur into the structure, which can enhance the compound's biological activity and stability. Additionally, the specific stereochemistry indicated by the (2R) designation suggests that the compound has a defined three-dimensional arrangement, which is crucial for its interaction with biological targets. Overall, this compound's unique combination of functional groups and stereochemistry makes it a subject of interest in synthetic chemistry and medicinal chemistry research.
Formula:C9H8BrF3OS
InChI:InChI=1S/C9H8BrF3OS/c10-6-1-3-7(4-2-6)15-5-8(14)9(11,12)13/h1-4,8,14H,5H2/t8-/m0/s1
InChI key:InChIKey=GGPGUJKIMVOAEX-QMMMGPOBSA-N
SMILES:S(C[C@@H](C(F)(F)F)O)C1=CC=C(Br)C=C1
Synonyms:- (2R)-3-[(4-Bromophenyl)thio]-1,1,1-trifluoro-2-propanol
- 2-Propanol, 3-[(4-bromophenyl)thio]-1,1,1-trifluoro-, (2R)-
- (2R)-3-[(4-BROMOPHENYL)SULFANYL]-1,1,1-TRIFLUORO-2-PROPANOL
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.