CymitQuimica logo

CAS 477768-38-0

:

N-[[[2,2-Dimethyl-1-[(methylamino)carbonyl]propyl]amino]thioxomethyl]glycine ethyl ester

Description:
N-[[[2,2-Dimethyl-1-[(methylamino)carbonyl]propyl]amino]thioxomethyl]glycine ethyl ester, with CAS number 477768-38-0, is a synthetic compound characterized by its complex structure, which includes a thioxomethyl group and an ethyl ester functional group. This compound features a glycine backbone, which is an amino acid, and is modified with a dimethyl-substituted propyl chain and a methylamino carbonyl group. The presence of the thioxomethyl moiety suggests potential reactivity, particularly in biological systems, where it may interact with various enzymes or receptors. The ethyl ester group can influence the solubility and bioavailability of the compound, making it relevant in pharmaceutical applications. Overall, this compound's unique structural features may confer specific biological activities, making it of interest in medicinal chemistry and drug development. However, detailed studies would be necessary to fully elucidate its properties, mechanisms of action, and potential therapeutic uses.
Formula:C12H23N3O3S
InChI:InChI=1S/C12H23N3O3S/c1-6-18-8(16)7-14-11(19)15-9(10(17)13-5)12(2,3)4/h9H,6-7H2,1-5H3,(H,13,17)(H2,14,15,19)
InChI key:InChIKey=WHCZUAKAMYGPCZ-UHFFFAOYSA-N
SMILES:C(NC(NCC(OCC)=O)=S)(C(NC)=O)C(C)(C)C
Synonyms:
  • Glycine, N-[[[2,2-dimethyl-1-[(methylamino)carbonyl]propyl]amino]thioxomethyl]-, ethyl ester
  • N-[[[2,2-Dimethyl-1-[(methylamino)carbonyl]propyl]amino]thioxomethyl]glycine ethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.