CAS 477846-41-6

3-[(4-Chlorophenyl)methyl]-4-hydroxy-1-(phenylmethyl)-2(1H)-pyridinone

Description:

3-[(4-Chlorophenyl)methyl]-4-hydroxy-1-(phenylmethyl)-2(1H)-pyridinone, with the CAS number 477846-41-6, is a synthetic organic compound characterized by its complex molecular structure, which includes a pyridinone core. This compound features a hydroxyl group and two aromatic substituents: a 4-chlorobenzyl group and a phenylmethyl group. The presence of the hydroxyl group contributes to its potential solubility in polar solvents and may influence its reactivity and biological activity. The chlorophenyl moiety can enhance lipophilicity, potentially affecting the compound's pharmacokinetics. This substance may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. As with many compounds, safety and handling precautions should be observed due to potential toxicity or reactivity. Further research is necessary to fully elucidate its applications and mechanisms of action in biological systems.

Formula: C₁₉H₁₆ClNO₂

InChI: InChI=1S/C19H16ClNO2/c20-16-8-6-14(7-9-16)12-17-18(22)10-11-21(19(17)23)13-15-4-2-1-3-5-15/h1-11,22H,12-13H2

InChI key: InChIKey=FXUIXWIFCVHFCL-UHFFFAOYSA-N

SMILES: C(C=1C(=O)N(CC2=CC=CC=C2)C=CC1O)C3=CC=C(Cl)C=C3

Synonyms:

• 3-[(4-Chlorophenyl)methyl]-4-hydroxy-1-(phenylmethyl)-2(1H)-pyridinone
• 2(1H)-Pyridinone, 3-[(4-chlorophenyl)methyl]-4-hydroxy-1-(phenylmethyl)-