CAS 477846-56-3

2-[[(4-Fluorophenyl)methyl]thio]-5-phenyl-1,3,4-oxadiazole

Description:

2-[[(4-Fluorophenyl)methyl]thio]-5-phenyl-1,3,4-oxadiazole, with the CAS number 477846-56-3, is a chemical compound characterized by its oxadiazole core, which is a five-membered heterocyclic ring containing two nitrogen atoms and three carbon atoms. This compound features a phenyl group and a 4-fluorophenylmethylthio substituent, contributing to its unique chemical properties. The presence of the fluorine atom enhances its electronic characteristics, potentially affecting its reactivity and interaction with biological targets. The thioether linkage introduces sulfur into the structure, which can influence solubility and stability. Generally, compounds of this type may exhibit interesting biological activities, making them of interest in medicinal chemistry and drug development. The oxadiazole moiety is often associated with various pharmacological properties, including antimicrobial and anti-inflammatory effects. However, specific biological activities and applications would require further investigation through experimental studies. Overall, this compound represents a class of heterocyclic compounds that are valuable in both synthetic and medicinal chemistry.

Formula: C₁₅H₁₁FN₂OS

InChI: InChI=1S/C15H11FN2OS/c16-13-8-6-11(7-9-13)10-20-15-18-17-14(19-15)12-4-2-1-3-5-12/h1-9H,10H2

InChI key: InChIKey=XAONHJPZVGOACX-UHFFFAOYSA-N

SMILES: S(CC1=CC=C(F)C=C1)C=2OC(=NN2)C3=CC=CC=C3

Synonyms:

• 2-[[(4-Fluorophenyl)methyl]thio]-5-phenyl-1,3,4-oxadiazole
• 1,3,4-Oxadiazole, 2-[[(4-fluorophenyl)methyl]thio]-5-phenyl-
• 2-[(4-Fluorobenzyl)sulfanyl]-5-phenyl-1,3,4-oxadiazole