CymitQuimica logo

CAS 477846-86-9

:

N-[3-Bromo-4-(4-methyl-1-piperazinyl)phenyl]-3-(trifluoromethyl)benzamide

Description:
N-[3-Bromo-4-(4-methyl-1-piperazinyl)phenyl]-3-(trifluoromethyl)benzamide, with the CAS number 477846-86-9, is a chemical compound characterized by its complex structure, which includes a brominated phenyl ring, a piperazine moiety, and a trifluoromethyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the bromine atom enhances its lipophilicity and may influence its interaction with biological targets. The trifluoromethyl group is known for its electron-withdrawing properties, which can affect the compound's reactivity and stability. Additionally, the piperazine ring is often associated with pharmacological activity, making this compound of interest in medicinal chemistry. Its unique combination of functional groups suggests potential applications in drug development, particularly in the fields of neuropharmacology or oncology. However, specific characteristics such as solubility, melting point, and biological activity would require empirical data for precise evaluation.
Formula:C19H19BrF3N3O
InChI:InChI=1S/C19H19BrF3N3O/c1-25-7-9-26(10-8-25)17-6-5-15(12-16(17)20)24-18(27)13-3-2-4-14(11-13)19(21,22)23/h2-6,11-12H,7-10H2,1H3,(H,24,27)
InChI key:InChIKey=PLWVZWVXSBQYDK-UHFFFAOYSA-N
SMILES:BrC1=C(C=CC(NC(=O)C2=CC(C(F)(F)F)=CC=C2)=C1)N3CCN(C)CC3
Synonyms:
  • N-[3-Bromo-4-(4-methyl-1-piperazinyl)phenyl]-3-(trifluoromethyl)benzamide
  • Benzamide, N-[3-bromo-4-(4-methyl-1-piperazinyl)phenyl]-3-(trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.