CymitQuimica logo

CAS 477848-28-5

:

1-Piperidineethanol, α-(trifluoromethyl)-, phenylcarbamate (ester)

Description:
1-Piperidineethanol, α-(trifluoromethyl)-, phenylcarbamate (ester), identified by CAS number 477848-28-5, is a chemical compound that features a piperidine ring, a trifluoromethyl group, and a phenylcarbamate moiety. This compound is characterized by its unique structural components, which contribute to its potential biological activity and chemical reactivity. The presence of the trifluoromethyl group often enhances lipophilicity and metabolic stability, making such compounds of interest in medicinal chemistry. The piperidine ring is a six-membered nitrogen-containing heterocycle that can influence the compound's pharmacological properties. Additionally, the phenylcarbamate structure may impart specific interactions with biological targets, potentially leading to applications in drug development. The compound's solubility, stability, and reactivity can vary based on its functional groups and overall molecular architecture. As with many chemical substances, safety and handling precautions are essential, particularly due to the presence of fluorinated groups, which can pose environmental and health risks.
Formula:C15H19F3N2O2
InChI:InChI=1S/C15H19F3N2O2/c16-15(17,18)13(11-20-9-5-2-6-10-20)22-14(21)19-12-7-3-1-4-8-12/h1,3-4,7-8,13H,2,5-6,9-11H2,(H,19,21)
InChI key:InChIKey=HNMYTUWOMJSUKU-UHFFFAOYSA-N
SMILES:C(CN1CCCCC1)(OC(NC2=CC=CC=C2)=O)C(F)(F)F
Synonyms:
  • 1,1,1-Trifluoro-3-(piperidin-1-yl)propan-2-yl phenylcarbamate
  • 1-Piperidineethanol, α-(trifluoromethyl)-, phenylcarbamate (ester)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.