
CAS 477854-23-2
:6-(2-Bromoacetyl)-2-(2,4-difluorophenyl)-4-methyl-1,2,4-triazine-3,5(2H,4H)-dione
Description:
6-(2-Bromoacetyl)-2-(2,4-difluorophenyl)-4-methyl-1,2,4-triazine-3,5(2H,4H)-dione, with CAS number 477854-23-2, is a synthetic organic compound characterized by its complex triazine structure, which includes a triazine ring and multiple functional groups. The presence of a bromoacetyl group suggests it has potential reactivity, particularly in nucleophilic substitution reactions. The difluorophenyl substituent indicates that the compound may exhibit unique electronic properties due to the electronegative fluorine atoms, which can influence its reactivity and interaction with biological targets. The methyl group contributes to the overall hydrophobic character of the molecule. This compound may possess biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Its stability, solubility, and reactivity can be influenced by the specific arrangement of its substituents, which can affect its potential applications in various fields, including medicinal chemistry and agrochemicals.
Formula:C12H8BrF2N3O3
InChI:InChI=1S/C12H8BrF2N3O3/c1-17-11(20)10(9(19)5-13)16-18(12(17)21)8-3-2-6(14)4-7(8)15/h2-4H,5H2,1H3
InChI key:InChIKey=PYENMUYQQFUVOD-UHFFFAOYSA-N
SMILES:O=C1N(N=C(C(CBr)=O)C(=O)N1C)C2=C(F)C=C(F)C=C2
Synonyms:- 6-(2-Bromoacetyl)-2-(2,4-difluorophenyl)-4-methyl-1,2,4-triazine-3,5(2H,4H)-dione
- 1,2,4-Triazine-3,5(2H,4H)-dione, 6-(bromoacetyl)-2-(2,4-difluorophenyl)-4-methyl-
- 1,2,4-Triazine-3,5(2H,4H)-dione, 6-(2-bromoacetyl)-2-(2,4-difluorophenyl)-4-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.