CymitQuimica logo

CAS 477854-79-8

:

Ethyl 4-(2,3-dimethylphenoxy)-2-phenyl-5-pyrimidinecarboxylate

Description:
Ethyl 4-(2,3-dimethylphenoxy)-2-phenyl-5-pyrimidinecarboxylate is a chemical compound characterized by its complex structure, which includes an ethyl ester functional group, a pyrimidine ring, and a phenoxy moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as moderate solubility in organic solvents and potential bioactivity due to its structural features. The presence of the pyrimidine ring suggests potential applications in pharmaceuticals, particularly in the development of compounds with antimicrobial or anti-inflammatory properties. Additionally, the dimethylphenyl group may contribute to the compound's lipophilicity, influencing its interaction with biological membranes. The compound's molecular structure allows for various chemical reactions, making it a candidate for further synthetic modifications. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact would depend on its concentration and exposure levels. Overall, this compound represents a class of organic molecules with potential utility in medicinal chemistry and related fields.
Formula:C21H20N2O3
InChI:InChI=1S/C21H20N2O3/c1-4-25-21(24)17-13-22-19(16-10-6-5-7-11-16)23-20(17)26-18-12-8-9-14(2)15(18)3/h5-13H,4H2,1-3H3
InChI key:InChIKey=BMUIXCLLFWRJOQ-UHFFFAOYSA-N
SMILES:O(C=1C(C(OCC)=O)=CN=C(N1)C2=CC=CC=C2)C3=C(C)C(C)=CC=C3
Synonyms:
  • Ethyl 4-(2,3-dimethylphenoxy)-2-phenyl-5-pyrimidinecarboxylate
  • 5-Pyrimidinecarboxylic acid, 4-(2,3-dimethylphenoxy)-2-phenyl-, ethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.