CAS 477859-28-2
:6-Methyl-3-[[[4-(1-methylethyl)phenyl]amino]methylene]-2H-pyran-2,4(3H)-dione
Description:
6-Methyl-3-[[[4-(1-methylethyl)phenyl]amino]methylene]-2H-pyran-2,4(3H)-dione, with the CAS number 477859-28-2, is a synthetic organic compound characterized by its complex structure, which includes a pyran ring and multiple functional groups. This compound typically exhibits properties associated with diketones and can participate in various chemical reactions due to the presence of the methylene and amino groups. It may display biological activity, making it of interest in pharmaceutical research. The presence of the isopropyl group on the phenyl ring suggests potential hydrophobic interactions, influencing its solubility and reactivity. Additionally, the methyl substitution on the pyran ring can affect its electronic properties and steric hindrance. Overall, this compound's unique structure contributes to its potential applications in medicinal chemistry and material science, although specific biological activities and physical properties would require empirical investigation for detailed characterization.
Formula:C16H17NO3
InChI:InChI=1S/C16H17NO3/c1-10(2)12-4-6-13(7-5-12)17-9-14-15(18)8-11(3)20-16(14)19/h4-10,17H,1-3H3
InChI key:InChIKey=RBSLZBARGDMSJG-UHFFFAOYSA-N
SMILES:C(NC1=CC=C(C(C)C)C=C1)=C2C(=O)C=C(C)OC2=O
Synonyms:- 6-Methyl-3-[[[4-(1-methylethyl)phenyl]amino]methylene]-2H-pyran-2,4(3H)-dione
- 2H-Pyran-2,4(3H)-dione, 6-methyl-3-[[[4-(1-methylethyl)phenyl]amino]methylene]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(3Z)-6-Methyl-3-({[4-(propan-2-yl)phenyl]amino}methylidene)-3,4-dihydro-2H-pyran-2,4-dione
CAS:(3Z)-6-Methyl-3-({[4-(propan-2-yl)phenyl]amino}methylidene)-3,4-dihydro-2H-pyran-2,4-dionePurity:techMolecular weight:271.31g/mol
