CymitQuimica logo

CAS 477863-87-9

:

5-Methoxy-2-phenyl-N-2-propen-1-yl-4-pyrimidinamine

Description:
5-Methoxy-2-phenyl-N-2-propen-1-yl-4-pyrimidinamine, identified by its CAS number 477863-87-9, is a chemical compound characterized by its unique structural features, which include a pyrimidine ring and a methoxy group. This compound typically exhibits properties associated with both aromatic and aliphatic systems due to the presence of the phenyl and propenyl groups. It may display moderate to high solubility in organic solvents, depending on the specific conditions and the presence of functional groups that can engage in hydrogen bonding or other interactions. The compound's biological activity may be influenced by its ability to interact with various biological targets, making it of interest in medicinal chemistry. Additionally, its stability can be affected by environmental factors such as pH and temperature. Overall, 5-Methoxy-2-phenyl-N-2-propen-1-yl-4-pyrimidinamine represents a complex structure that may have potential applications in pharmaceuticals or agrochemicals, warranting further investigation into its properties and effects.
Formula:C14H15N3O
InChI:InChI=1S/C14H15N3O/c1-3-9-15-14-12(18-2)10-16-13(17-14)11-7-5-4-6-8-11/h3-8,10H,1,9H2,2H3,(H,15,16,17)
InChI key:InChIKey=JOGNQLLSGJZTCJ-UHFFFAOYSA-N
SMILES:N(CC=C)C1=NC(=NC=C1OC)C2=CC=CC=C2
Synonyms:
  • 4-Pyrimidinamine, 5-methoxy-2-phenyl-N-2-propen-1-yl-
  • 4-Pyrimidinamine, 5-methoxy-2-phenyl-N-2-propenyl-
  • 5-Methoxy-2-phenyl-N-2-propen-1-yl-4-pyrimidinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.