CAS 477864-29-2
:1,1,1-Trifluoro-3-[[2-(4-morpholinyl)ethyl]amino]-2-propanol
Description:
1,1,1-Trifluoro-3-[[2-(4-morpholinyl)ethyl]amino]-2-propanol, with CAS number 477864-29-2, is a chemical compound characterized by its unique trifluoromethyl group and a morpholine moiety. This compound features a propanol backbone, which contributes to its solubility and reactivity. The presence of trifluoromethyl groups often enhances the lipophilicity and metabolic stability of the molecule, making it of interest in pharmaceutical applications. The morpholine ring introduces basic nitrogen functionality, which can participate in hydrogen bonding and influence the compound's interaction with biological targets. Additionally, the ethyl linker provides flexibility, potentially affecting the compound's conformation and biological activity. Overall, this compound may exhibit properties suitable for use in medicinal chemistry, particularly in the development of therapeutics targeting specific biological pathways. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its behavior in biological systems would be assessed through various pharmacological studies.
Formula:C9H17F3N2O2
InChI:InChI=1S/C9H17F3N2O2/c10-9(11,12)8(15)7-13-1-2-14-3-5-16-6-4-14/h8,13,15H,1-7H2
InChI key:InChIKey=UIZUPHKRPBPSQO-UHFFFAOYSA-N
SMILES:C(CNCC(C(F)(F)F)O)N1CCOCC1
Synonyms:- 1,1,1-Trifluoro-3-[[2-(4-morpholinyl)ethyl]amino]-2-propanol
- 2-Propanol, 1,1,1-trifluoro-3-[[2-(4-morpholinyl)ethyl]amino]-
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery