CAS 477864-99-6
:1-(Dimethylamino)-4-(4-methylphenoxy)-1-penten-3-one
Description:
1-(Dimethylamino)-4-(4-methylphenoxy)-1-penten-3-one, with the CAS number 477864-99-6, is an organic compound characterized by its unique structural features. It contains a dimethylamino group, which contributes to its basicity and potential as a nucleophile in chemical reactions. The presence of a 4-methylphenoxy group indicates that it has aromatic characteristics, which can influence its reactivity and solubility. The compound features a conjugated system due to the presence of a pentenone moiety, which can enhance its stability and reactivity in various chemical processes, including potential applications in organic synthesis and medicinal chemistry. Its molecular structure suggests that it may exhibit interesting electronic properties, making it a candidate for studies in materials science or as a potential pharmaceutical agent. Additionally, the compound's physical properties, such as boiling point, melting point, and solubility, would depend on its molecular interactions and the presence of functional groups, which can significantly affect its behavior in different environments.
Formula:C14H19NO2
InChI:InChI=1S/C14H19NO2/c1-11-5-7-13(8-6-11)17-12(2)14(16)9-10-15(3)4/h5-10,12H,1-4H3
InChI key:InChIKey=JPRORLRLNDTXLH-UHFFFAOYSA-N
SMILES:O(C(C(C=CN(C)C)=O)C)C1=CC=C(C)C=C1
Synonyms:- 1-Penten-3-one, 1-(dimethylamino)-4-(4-methylphenoxy)-
- 1-(Dimethylamino)-4-(4-methylphenoxy)-1-penten-3-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(1E)-1-(Dimethylamino)-4-(4-methylphenoxy)pent-1-en-3-one
CAS:<p>(1E)-1-(Dimethylamino)-4-(4-methylphenoxy)pent-1-en-3-one</p>Purity:techMolecular weight:233.31g/mol
