CAS 477871-55-9

Methyl 2-[(4-fluorobenzoyl)oxy]-4-(1H-pyrrol-1-yl)benzoate

Description:

Methyl 2-[(4-fluorobenzoyl)oxy]-4-(1H-pyrrol-1-yl)benzoate, with the CAS number 477871-55-9, is a synthetic organic compound characterized by its complex structure, which includes a methyl ester functional group, a fluorobenzoyl moiety, and a pyrrole ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as moderate to high lipophilicity, which can influence its solubility in organic solvents. The presence of the fluorine atom may enhance its biological activity and stability, making it of interest in pharmaceutical research. Additionally, the ester functional group suggests potential reactivity in hydrolysis or transesterification reactions. Its structural features may confer specific interactions with biological targets, which is relevant for its potential applications in medicinal chemistry. Overall, this compound represents a class of molecules that may be explored for their therapeutic properties, particularly in the development of new drugs or agrochemicals.

Formula: C₁₉H₁₄FNO₄

InChI: InChI=1S/C19H14FNO4/c1-24-19(23)16-9-8-15(21-10-2-3-11-21)12-17(16)25-18(22)13-4-6-14(20)7-5-13/h2-12H,1H3

InChI key: InChIKey=ZYODSFYRATYCKU-UHFFFAOYSA-N

SMILES: O(C(=O)C1=CC=C(F)C=C1)C2=C(C(OC)=O)C=CC(=C2)N3C=CC=C3

Synonyms:

• Methyl 2-[(4-fluorobenzoyl)oxy]-4-(1H-pyrrol-1-yl)benzoate
• Benzoic acid, 2-[(4-fluorobenzoyl)oxy]-4-(1H-pyrrol-1-yl)-, methyl ester