CAS 477886-99-0

2-(4-Iodophenoxy)benzenemethanol

Description:

2-(4-Iodophenoxy)benzenemethanol is an organic compound characterized by its complex structure, which includes a phenolic hydroxyl group and an iodine substituent on the aromatic ring. This compound features a biphenyl system where one of the phenyl rings is substituted with an iodine atom, enhancing its reactivity and potential applications in various chemical reactions. The presence of the hydroxymethyl group contributes to its solubility in polar solvents and may influence its biological activity. Typically, compounds like this can exhibit interesting properties such as antimicrobial or anti-inflammatory activities, making them of interest in medicinal chemistry. Additionally, the iodine atom can serve as a useful handle for further chemical modifications, allowing for the synthesis of derivatives with tailored properties. The molecular weight, melting point, and specific reactivity would depend on the precise conditions and methods used in its synthesis and characterization. Overall, 2-(4-Iodophenoxy)benzenemethanol represents a versatile scaffold for further chemical exploration and potential applications in pharmaceuticals and materials science.

Formula: C₁₃H₁₁IO₂

InChI: InChI=1S/C13H11IO2/c14-11-5-7-12(8-6-11)16-13-4-2-1-3-10(13)9-15/h1-8,15H,9H2

InChI key: InChIKey=MZZAVJVDQDFIFU-UHFFFAOYSA-N

SMILES: O(C1=C(CO)C=CC=C1)C2=CC=C(I)C=C2

Synonyms:

• 2-(4-Iodophenoxy)benzenemethanol
• Benzenemethanol, 2-(4-iodophenoxy)-

[2-(4-Iodophenoxy)phenyl]methanol

CAS: 477886-99-0

Versatile small molecule scaffold

Formula: C₁₃H₁₁IO₂

Purity: Min. 95%

Molecular weight: 326.13 g/mol

Ref: 3D-CUA88699