
CAS 478-14-8
:(-)-Capaurine
Description:
(-)-Capaurine is a naturally occurring alkaloid primarily derived from the plant species of the genus Psychotria, particularly Psychotria capura. It is characterized by its complex molecular structure, which includes a bicyclic framework. The compound exhibits a chiral center, resulting in its designation as "(-)" indicating its specific optical activity. (-)-Capaurine is known for its potential pharmacological properties, including antimalarial and analgesic effects, which have garnered interest in medicinal chemistry. The substance is typically found in the form of a white to off-white crystalline solid and is soluble in organic solvents. Its chemical behavior is influenced by the presence of functional groups that can participate in various chemical reactions. As with many alkaloids, (-)-Capaurine may also exhibit biological activity, making it a subject of research in the fields of pharmacology and natural product chemistry. Safety and handling precautions are essential when working with this compound due to its biological activity and potential toxicity.
Formula:C21H25NO5
InChI:InChI=1S/C21H25NO5/c1-24-16-6-5-12-9-15-18-13(10-17(25-2)21(27-4)19(18)23)7-8-22(15)11-14(12)20(16)26-3/h5-6,10,15,23H,7-9,11H2,1-4H3/t15-/m0/s1
InChI key:InChIKey=GSPIMPLJQOCBFY-HNNXBMFYSA-N
SMILES:OC1=C2[C@]3(N(CC=4C(C3)=CC=C(OC)C4OC)CCC2=CC(OC)=C1OC)[H]
Synonyms:- (13aS)-5,8,13,13a-Tetrahydro-2,3,9,10-tetramethoxy-6H-dibenzo[a,g]quinolizin-1-ol
- 13aα-Berbin-1-ol, 2,3,9,10-tetramethoxy-
- 6H-Dibenzo[a,g]quinolizin-1-ol, 5,8,13,13a-tetrahydro-2,3,9,10-tetramethoxy-, (S)-
- 6H-Dibenzo[a,g]quinolizin-1-ol, 5,8,13,13a-tetrahydro-2,3,9,10-tetramethoxy-, (13aS)-
- Capaurine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
