CAS 478-42-2
:4-Hydroxy-9-methoxy-7-methyl-5H-furo[3,2-g][1]benzopyran-5-one
Description:
4-Hydroxy-9-methoxy-7-methyl-5H-furo[3,2-g][1]benzopyran-5-one, with CAS number 478-42-2, is a naturally occurring compound belonging to the class of flavonoids, specifically a type of coumarin. This compound is characterized by its complex polycyclic structure, which includes a furan and benzopyran moiety. It typically exhibits a range of biological activities, including antioxidant, anti-inflammatory, and potential anticancer properties, making it of interest in pharmacological research. The presence of hydroxyl and methoxy functional groups contributes to its reactivity and solubility in various solvents. Its molecular structure allows for interactions with various biological targets, which may enhance its therapeutic potential. Additionally, this compound may be found in certain plants, contributing to their medicinal properties. As with many flavonoids, it is also studied for its role in plant pigmentation and UV protection. Overall, 4-Hydroxy-9-methoxy-7-methyl-5H-furo[3,2-g][1]benzopyran-5-one represents a significant compound in both natural product chemistry and medicinal research.
Formula:C13H10O5
InChI:InChI=1S/C13H10O5/c1-6-5-8(14)9-10(15)7-3-4-17-11(7)13(16-2)12(9)18-6/h3-5,15H,1-2H3
InChI key:InChIKey=GEYVZPGXYUDRSN-UHFFFAOYSA-N
SMILES:OC=1C2=C(C(OC)=C3C1C=CO3)OC(C)=CC2=O
Synonyms:- 5-Norkhellin
- 4-Hydroxy-9-methoxy-7-methyl-5H-furo[3,2-g][1]benzopyran-5-one
- Khellinol
- 5H-Furo[3,2-g][1]benzopyran-5-one, 4-hydroxy-9-methoxy-7-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
