CymitQuimica logo

CAS 478-45-5

:

Emodic acid

Description:
Emodic acid, with the CAS number 478-45-5, is a naturally occurring compound primarily derived from various plant sources, particularly from the genus Rheum, such as rhubarb. It is classified as a phenolic compound and is known for its distinctive chemical structure, which includes a chromone backbone. Emodic acid exhibits a range of biological activities, including anti-inflammatory, antioxidant, and potential anticancer properties, making it of interest in pharmacological research. The compound is typically characterized by its solubility in organic solvents and limited solubility in water, which is common for many phenolic compounds. Its molecular interactions and mechanisms of action are subjects of ongoing studies, particularly in the context of traditional medicine and modern therapeutic applications. Additionally, emodic acid may undergo various chemical transformations, influencing its reactivity and biological efficacy. Overall, its unique properties and potential health benefits contribute to its significance in both natural product chemistry and medicinal research.
Formula:C15H8O7
InChI:InChI=1S/C15H8O7/c16-6-3-8-12(10(18)4-6)14(20)11-7(13(8)19)1-5(15(21)22)2-9(11)17/h1-4,16-18H,(H,21,22)
InChI key:InChIKey=ZJXVNNSMRGTDBI-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)C=3C1=C(O)C=C(O)C3)=CC(C(O)=O)=CC2O
Synonyms:
  • 2-Anthracenecarboxylic acid, 9,10-dihydro-4,5,7-trihydroxy-9,10-dioxo-
  • 2-Anthroic acid, 9,10-dihydro-4,5,7-trihydroxy-9,10-dioxo-
  • 9,10-Dihydro-4,5,7-trihydroxy-9,10-dioxo-2-anthracenecarboxylic acid
  • NSC 624610
  • Emodic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • Emodic acid

    CAS:
    Emodic acid is a useful organic compound for research related to life sciences. The catalog number is T124807 and the CAS number is 478-45-5.
    Formula:C15H8O7
    Color and Shape:Solid
    Molecular weight:300.222

    Ref: TM-T124807

    1mg
    To inquire
    5mg
    To inquire