CAS 478-76-2
:(6aR)-10,11-dihydroxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolinium chloride
Description:
(6aR)-10,11-dihydroxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolinium chloride, with CAS number 478-76-2, is a chemical compound that belongs to the class of dibenzoquinolinium derivatives. This substance is characterized by its complex polycyclic structure, which includes multiple fused aromatic rings. The presence of hydroxyl groups at the 10 and 11 positions contributes to its potential reactivity and solubility in various solvents. As a quaternary ammonium compound, it may exhibit properties typical of such compounds, including antimicrobial activity and the ability to interact with biological membranes. The chloride ion associated with the compound serves as a counterion, influencing its solubility and stability in solution. This compound is of interest in various fields, including medicinal chemistry and pharmacology, due to its potential biological activities. However, specific applications and safety profiles should be evaluated based on further research and context.
Formula:C16H16ClNO2
InChI:InChI=1/C16H15NO2.ClH/c18-13-5-4-10-8-12-14-9(6-7-17-12)2-1-3-11(14)15(10)16(13)19;/h1-5,12,17-19H,6-8H2;1H/t12-;/m1./s1
SMILES:c1cc2CCN[C@@H]3Cc4ccc(c(c4c(c1)c23)O)O.Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
