CAS 478-95-5
:6-methyl-9,10-didehydroergoline-8-carboxylic acid
Description:
6-Methyl-9,10-didehydroergoline-8-carboxylic acid, with the CAS number 478-95-5, is a chemical compound belonging to the ergoline family, which is characterized by a tetracyclic structure derived from the ergot alkaloids. This compound features a methyl group at the 6-position and a carboxylic acid functional group at the 8-position, contributing to its unique chemical properties. It is known for its potential biological activity, particularly in relation to the central nervous system, where it may interact with various neurotransmitter receptors. The presence of the didehydro configuration indicates that it has undergone dehydrogenation, affecting its reactivity and stability. This compound is typically studied in the context of pharmacology and medicinal chemistry, where its structural modifications can influence its efficacy and safety profile. As with many ergoline derivatives, it may exhibit a range of effects, including psychoactive properties, making it of interest in both therapeutic and research settings. Proper handling and safety measures are essential due to its potential biological activity.
Formula:C16H16N2O2
InChI:InChI=1/C16H16N2O2/c1-18-8-10(16(19)20)5-12-11-3-2-4-13-15(11)9(7-17-13)6-14(12)18/h2-5,7,10,14,17H,6,8H2,1H3,(H,19,20)
SMILES:CN1CC(C=C2c3cccc4c3c(CC12)c[nH]4)C(=O)O
Synonyms:- (8Alpha)-6-Methyl-9,10-Didehydroergoline-8-Carboxylic Acid
- (8a)-9,10-Didehydro-6-methyl ergo line-8-carboxylic acid
- (8alpha)-9,10-Didehydro-6-methylergoline-8-carboxylic acid
- Ergoline-8-carboxylic acid, 9,10-didehydro-6-methyl-, (8alpha)-
- Isolysergic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

