CAS 4780-64-7

2,4-dihydroxy-5-methylbenzoic acid

Description:

2,4-Dihydroxy-5-methylbenzoic acid, also known as gentisic acid, is an aromatic compound characterized by the presence of two hydroxyl groups and a carboxylic acid group attached to a benzene ring. Its molecular structure features a methyl group at the 5-position, contributing to its unique properties. This compound is typically a white to pale yellow crystalline solid, soluble in water and organic solvents, which enhances its utility in various applications. It exhibits antioxidant properties and is often studied for its potential health benefits, including anti-inflammatory and antimicrobial effects. The presence of multiple functional groups allows for various chemical reactions, making it a versatile intermediate in organic synthesis. Additionally, its derivatives may be explored in pharmaceuticals, agrochemicals, and as a potential food preservative. Safety data indicates that while it is generally considered low in toxicity, standard precautions should be taken when handling the substance in laboratory settings.

Formula: C₈H₈O₄

InChI: InChI=1/C8H8O4/c1-4-2-5(8(11)12)7(10)3-6(4)9/h2-3,9-10H,1H3,(H,11,12)

SMILES: Cc1cc(c(cc1O)O)C(=O)O

2,4-Dihydroxy-5-methylbenzoic Acid

Controlled Product

CAS: 4780-64-7

Formula: C₈H₈O₄

Color and Shape: Neat

Molecular weight: 168.147

Ref: TR-D494965

2,4-Dihydroxy-5-methylbenzoic acid

CAS: 4780-64-7

2,4-Dihydroxy-5-methylbenzoic acid is a high quality chemical that can be used as a reagent, intermediate, or building block. It has many uses in the production of fine chemicals and research chemicals. 2,4-Dihydroxy-5-methylbenzoic acid is also a versatile building block for organic synthesis reactions. This compound has shown to have anti-inflammatory properties and may be useful as a treatment for arthritis.

Formula: C₈H₈O₄

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 168.15 g/mol

Ref: 3D-FD66662