CAS 478047-23-3
:4,6-Dimethyl-3-(1H-pyrrol-1-yl)-1H-pyrazolo[3,4-b]pyridine-1-acetonitrile
Description:
4,6-Dimethyl-3-(1H-pyrrol-1-yl)-1H-pyrazolo[3,4-b]pyridine-1-acetonitrile is a chemical compound characterized by its complex heterocyclic structure, which includes a pyrazolo-pyridine core and a pyrrole substituent. This compound typically exhibits properties associated with heterocycles, such as potential biological activity and the ability to participate in various chemical reactions. It may be soluble in organic solvents, and its solubility can vary depending on the specific solvent and conditions. The presence of the acetonitrile group suggests that it may have polar characteristics, influencing its reactivity and interactions with other molecules. Additionally, compounds of this nature are often studied for their pharmacological properties, including potential applications in medicinal chemistry. The specific characteristics, such as melting point, boiling point, and spectral data, would require empirical measurement or detailed literature references for precise values. Overall, this compound represents a class of molecules that are of interest in both synthetic and medicinal chemistry.
Formula:C14H13N5
InChI:InChI=1S/C14H13N5/c1-10-9-11(2)16-13-12(10)14(17-19(13)8-5-15)18-6-3-4-7-18/h3-4,6-7,9H,8H2,1-2H3
InChI key:InChIKey=AGNYBDJTTMPFHC-UHFFFAOYSA-N
SMILES:CC1=C2C(=NN(CC#N)C2=NC(C)=C1)N3C=CC=C3
Synonyms:- 2-(4,6-Dimethyl-3-(1H-pyrrol-1-yl)-1H-pyrazolo[3,4-b]pyridin-1-yl)acetonitrile
- 4,6-Dimethyl-3-(1H-pyrrol-1-yl)-1H-pyrazolo[3,4-b]pyridine-1-acetonitrile
- 1H-Pyrazolo[3,4-b]pyridine-1-acetonitrile, 4,6-dimethyl-3-(1H-pyrrol-1-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-[4,6-Dimethyl-3-(1H-pyrrol-1-yl)-1H-pyrazolo[3,4-b]pyridin-1-yl]acetonitrile
CAS:2-[4,6-Dimethyl-3-(1H-pyrrol-1-yl)-1H-pyrazolo[3,4-b]pyridin-1-yl]acetonitrile
Purity:techMolecular weight:251.29g/mol
