CAS 478068-13-2
:α-(Trifluoromethyl)-4-thiomorpholineethanol
Description:
α-(Trifluoromethyl)-4-thiomorpholineethanol is a chemical compound characterized by the presence of a trifluoromethyl group and a thiomorpholine ring, which contributes to its unique properties. The trifluoromethyl group is known for enhancing the lipophilicity and metabolic stability of compounds, making them more effective in various applications, particularly in pharmaceuticals. The thiomorpholine moiety introduces a sulfur atom into the structure, which can influence the compound's reactivity and interaction with biological systems. This compound is likely to exhibit polar characteristics due to the hydroxyl (-OH) group, which can participate in hydrogen bonding, enhancing its solubility in polar solvents. Additionally, the presence of fluorine atoms typically imparts distinctive electronic properties, potentially affecting the compound's biological activity. Overall, α-(Trifluoromethyl)-4-thiomorpholineethanol is of interest in medicinal chemistry and material science due to its unique structural features and potential applications. However, specific safety and handling guidelines should be followed, as with any chemical substance.
Formula:C7H12F3NOS
InChI:InChI=1S/C7H12F3NOS/c8-7(9,10)6(12)5-11-1-3-13-4-2-11/h6,12H,1-5H2
InChI key:InChIKey=VULXDDBOUZXLRM-UHFFFAOYSA-N
SMILES:C(C(C(F)(F)F)O)N1CCSCC1
Synonyms:- α-(Trifluoromethyl)-4-thiomorpholineethanol
- 4-Thiomorpholineethanol, α-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,1,1-Trifluoro-3-(thiomorpholin-4-yl)propan-2-ol
CAS:1,1,1-Trifluoro-3-(thiomorpholin-4-yl)propan-2-olPurity:techMolecular weight:215.24g/mol
