
CAS 478079-01-5
:1-[4-[3-Chloro-5-(trifluoromethyl)-2-pyridinyl]-1-piperazinyl]-2-phenyl-3-(2-thienyl)-2-propen-1-one
Description:
1-[4-[3-Chloro-5-(trifluoromethyl)-2-pyridinyl]-1-piperazinyl]-2-phenyl-3-(2-thienyl)-2-propen-1-one, with the CAS number 478079-01-5, is a synthetic organic compound characterized by its complex structure, which includes a piperazine moiety, a pyridine ring, and a thienyl group. This compound typically exhibits properties associated with its functional groups, such as potential biological activity, making it of interest in medicinal chemistry. The presence of the trifluoromethyl group often enhances lipophilicity and metabolic stability, while the chloro substituent may influence its reactivity and interaction with biological targets. The compound's propenone structure suggests it may participate in various chemical reactions, including Michael additions or condensation reactions. Its specific applications and efficacy would depend on its interaction with biological systems, which could be explored through pharmacological studies. Overall, this compound represents a class of molecules that may have potential therapeutic applications, particularly in the fields of neuropharmacology or oncology, although detailed studies would be necessary to elucidate its full profile.
Formula:C23H19ClF3N3OS
InChI:InChI=1S/C23H19ClF3N3OS/c24-20-13-17(23(25,26)27)15-28-21(20)29-8-10-30(11-9-29)22(31)19(14-18-7-4-12-32-18)16-5-2-1-3-6-16/h1-7,12-15H,8-11H2
InChI key:InChIKey=IQRIJCMDOZYGEE-UHFFFAOYSA-N
SMILES:C(C(=O)N1CCN(CC1)C2=C(Cl)C=C(C(F)(F)F)C=N2)(=CC3=CC=CS3)C4=CC=CC=C4
Synonyms:- 2-Propen-1-one, 1-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-1-piperazinyl]-2-phenyl-3-(2-thienyl)-
- Piperazine, 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-4-[1-oxo-2-phenyl-3-(2-thienyl)-2-propenyl]-
- 1-[4-[3-Chloro-5-(trifluoromethyl)-2-pyridinyl]-1-piperazinyl]-2-phenyl-3-(2-thienyl)-2-propen-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.