CymitQuimica logo

CAS 478080-01-2

:

Methyl 3-[(4-methylbenzoyl)amino]-2-thiophenecarboxylate

Description:
Methyl 3-[(4-methylbenzoyl)amino]-2-thiophenecarboxylate, identified by its CAS number 478080-01-2, is an organic compound characterized by its complex structure, which includes a thiophene ring, an amide linkage, and a methyl ester functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups. The thiophene moiety contributes to its electronic properties, making it potentially useful in various applications, including pharmaceuticals and organic synthesis. The presence of the 4-methylbenzoyl group may enhance its stability and influence its biological activity. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, allowing for its identification and characterization in laboratory settings. Overall, this compound's unique structural features suggest potential utility in medicinal chemistry and materials science, although specific applications would depend on further research and development.
Formula:C14H13NO3S
InChI:InChI=1S/C14H13NO3S/c1-9-3-5-10(6-4-9)13(16)15-11-7-8-19-12(11)14(17)18-2/h3-8H,1-2H3,(H,15,16)
InChI key:InChIKey=XXUKRIGBSDYHFL-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(NC(=O)C2=CC=C(C)C=C2)C=CS1
Synonyms:
  • 3-((4-Methylbenzoyl)amino)-2-thiophenecarboxylic acid methyl ester
  • 2-Thiophenecarboxylic acid, 3-[(4-methylbenzoyl)amino]-, methyl ester
  • Methyl 3-[(4-methylbenzoyl)amino]-2-thiophenecarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.