CymitQuimica logo

CAS 478081-36-6

:

3-[[(2-Chlorophenyl)methyl]amino]-1,1,1-trifluoro-2-propanol

Description:
3-[[(2-Chlorophenyl)methyl]amino]-1,1,1-trifluoro-2-propanol, with the CAS number 478081-36-6, is a chemical compound characterized by its unique structure that includes a trifluoropropanol moiety and a chlorophenyl group. This compound typically exhibits properties associated with both alcohols and amines, such as the ability to engage in hydrogen bonding due to the hydroxyl (-OH) group. The presence of the trifluoromethyl group imparts significant lipophilicity and can influence the compound's reactivity and solubility in organic solvents. Additionally, the chlorophenyl substituent may contribute to the compound's biological activity, potentially affecting its pharmacological properties. The compound's molecular structure suggests it may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its stability, reactivity, and interactions with biological systems would be critical areas for further investigation, especially in the context of drug design and synthesis.
Formula:C10H11ClF3NO
InChI:InChI=1S/C10H11ClF3NO/c11-8-4-2-1-3-7(8)5-15-6-9(16)10(12,13)14/h1-4,9,15-16H,5-6H2
InChI key:InChIKey=ZQKVNHAZMRKIIU-UHFFFAOYSA-N
SMILES:C(NCC(C(F)(F)F)O)C1=C(Cl)C=CC=C1
Synonyms:
  • 3-[[(2-Chlorophenyl)methyl]amino]-1,1,1-trifluoro-2-propanol
  • 2-Propanol, 3-[[(2-chlorophenyl)methyl]amino]-1,1,1-trifluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.