CAS 478132-11-5

(αS)-8,9-Dihydro-α-methylpyrano[2,3-g]indazole-1(7H)-ethanamine

Description:

(αS)-8,9-Dihydro-α-methylpyrano[2,3-g]indazole-1(7H)-ethanamine, with CAS number 478132-11-5, is a chemical compound characterized by its unique structural features, which include a pyranoindazole framework. This compound exhibits a chiral center, contributing to its stereochemistry, specifically the (αS) configuration. It is typically classified as a heterocyclic compound due to the presence of nitrogen in its indazole moiety. The presence of an ethanamine functional group suggests potential biological activity, possibly influencing neurotransmitter systems or other physiological pathways. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other substances. Its synthesis and characterization may involve various organic chemistry techniques, including chromatography and spectroscopy, to confirm purity and structural integrity. While specific applications may not be widely documented, compounds of this nature are often explored in medicinal chemistry for their potential therapeutic effects. Further research is necessary to fully elucidate its properties and potential uses in pharmacology or related fields.

Formula: C₁₃H₁₇N₃O

InChI: InChI=1S/C13H17N3O/c1-9(14)8-16-13-10(7-15-16)4-5-12-11(13)3-2-6-17-12/h4-5,7,9H,2-3,6,8,14H2,1H3/t9-/m0/s1

InChI key: InChIKey=FJRIVFVALIEIOY-VIFPVBQESA-N

SMILES: C([C@H](C)N)N1C=2C3=C(C=CC2C=N1)OCCC3

Synonyms:

• (S)-(-)-2-(8,9-Dihydro-7H-pyrano[2,3-g]indazol-1-yl)-1-methylethylamine
• Pyrano[2,3-g]indazole-1(7H)-ethanamine, 8,9-dihydro-α-methyl-, (αS)-
• (αS)-8,9-Dihydro-α-methylpyrano[2,3-g]indazole-1(7H)-ethanamine

AL-38022A

CAS: 478132-11-5

AL-38022A: selective 5-HT2 ligand, Ki ≤2.2 nM; >100-fold less binding to other 5-HT; minimal interaction with non-5-HT targets; full agonist.

Formula: C₁₃H₁₇N₃O

Color and Shape: Solid

Molecular weight: 231.29

Ref: TM-T69206