CAS 478149-07-4

Thieno[3,2-c]pyridine-2-carboxylic acid, methyl ester

Description:

Thieno[3,2-c]pyridine-2-carboxylic acid, methyl ester is a heterocyclic organic compound characterized by its unique bicyclic structure that incorporates both a thieno and a pyridine ring. This compound features a carboxylic acid functional group that is esterified with a methyl group, enhancing its solubility and reactivity. It typically exhibits moderate polarity due to the presence of the ester and carboxylic acid functionalities, which can participate in hydrogen bonding. The compound is often utilized in medicinal chemistry and organic synthesis, serving as a building block for various pharmaceuticals and agrochemicals. Its structural characteristics may contribute to biological activity, making it of interest in drug discovery. Additionally, the compound's stability and reactivity can be influenced by the electronic properties of the heteroatoms in the thieno and pyridine rings. Overall, Thieno[3,2-c]pyridine-2-carboxylic acid, methyl ester is a versatile compound with potential applications in various fields of chemistry and biology.

Formula: C₉H₇NO₂S

InChI: InChI=1S/C9H7NO2S/c1-12-9(11)8-4-6-5-10-3-2-7(6)13-8/h2-5H,1H3

InChI key: InChIKey=HAAMRBSFJYFWFW-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=CC=2C(S1)=CC=NC2

Synonyms:

• Methyl thieno[3,2-c]pyridine-2-carboxylate
• Thieno[3,2-c]pyridine-2-carboxylic acid, methyl ester

METHYL THIENO[3,2-C]PYRIDINE-2-CARBOXYLATE

CAS: 478149-07-4

Formula: C₉H₇NO₂S

Purity: 95%

Molecular weight: 193.22

Ref: 10-F331439

Methyl thieno[3,2-c]pyridine-2-carboxylate

CAS: 478149-07-4

Versatile small molecule scaffold

Formula: C₉H₇NO₂S

Purity: Min. 95%

Molecular weight: 193.22 g/mol

Ref: 3D-DUA14907