CymitQuimica logo

CAS 478190-79-3

:

Silane, [(2,5-dibromo-1,4-phenylene)di-2,1-ethynediyl]bis[trimethyl-

Description:
Silane, specifically the compound with the name "[(2,5-dibromo-1,4-phenylene)di-2,1-ethynediyl]bis[trimethyl-," is a silane derivative characterized by its unique structure that includes a silane group bonded to a complex organic framework. This compound features a phenylene unit substituted with bromine atoms, which can influence its reactivity and physical properties. The presence of ethynediyl linkages contributes to its potential applications in materials science, particularly in the synthesis of polymers or as a coupling agent in composite materials. Silanes are generally known for their ability to bond with various substrates, enhancing adhesion and stability. The trimethyl groups attached to the silane provide steric bulk, which can affect the compound's solubility and reactivity. Overall, this silane derivative may exhibit interesting electronic and optical properties due to its conjugated structure, making it a candidate for research in advanced materials and nanotechnology. However, specific safety and handling guidelines should be followed due to the presence of bromine, which can pose health risks.
Formula:C16H20Br2Si2
InChI:InChI=1S/C16H20Br2Si2/c1-19(2,3)9-7-13-11-16(18)14(12-15(13)17)8-10-20(4,5)6/h11-12H,1-6H3
InChI key:TUMMIWKEWMEYTF-UHFFFAOYSA-N
SMILES:C[Si](C)(C)C#CC1=CC(=C(C=C1Br)C#C[Si](C)(C)C)Br
Found 3 products.