CAS 478247-68-6

[4-Amino-2-(2-propen-1-ylamino)-5-thiazolyl](4-nitrophenyl)methanone

Description:

[4-Amino-2-(2-propen-1-ylamino)-5-thiazolyl](4-nitrophenyl)methanone, with the CAS number 478247-68-6, is a synthetic organic compound characterized by its complex structure that includes a thiazole ring, an amine group, and a nitrophenyl moiety. This compound typically exhibits properties such as moderate solubility in polar solvents and potential biological activity, which may include antimicrobial or anticancer effects, although specific biological data would need to be referenced for precise applications. The presence of both amino and nitro groups suggests that it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Its thiazole component contributes to its potential as a pharmacophore in medicinal chemistry. As with many synthetic compounds, safety data, including toxicity and handling precautions, should be consulted before use in laboratory or industrial settings. Overall, this compound represents a class of molecules that may have significant implications in drug discovery and development.

Formula: C₁₃H₁₂N₄O₃S

InChI: InChI=1S/C13H12N4O3S/c1-2-7-15-13-16-12(14)11(21-13)10(18)8-3-5-9(6-4-8)17(19)20/h2-6H,1,7,14H2,(H,15,16)

InChI key: InChIKey=WEMUQGJPZVPURD-UHFFFAOYSA-N

SMILES: C(=O)(C=1SC(NCC=C)=NC1N)C2=CC=C(N(=O)=O)C=C2

Synonyms:

• Methanone, [4-amino-2-(2-propen-1-ylamino)-5-thiazolyl](4-nitrophenyl)-
• [4-Amino-2-(2-propen-1-ylamino)-5-thiazolyl](4-nitrophenyl)methanone
• Methanone, [4-amino-2-(2-propenylamino)-5-thiazolyl](4-nitrophenyl)-