CymitQuimica logo

CAS 478260-03-6

:

β-(3-Fluorophenyl)-1,3-dihydro-1-oxo-2H-isoindole-2-propanoic acid

Description:
β-(3-Fluorophenyl)-1,3-dihydro-1-oxo-2H-isoindole-2-propanoic acid is a chemical compound characterized by its unique isoindole structure, which features a fused bicyclic system. The presence of a fluorine atom on the phenyl ring enhances its lipophilicity and may influence its biological activity. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of the carboxylic acid functional group. The molecular structure suggests that it may participate in various chemical reactions, including esterification and amidation. Its potential applications could span medicinal chemistry, particularly in the development of pharmaceuticals, due to the isoindole framework, which is often associated with bioactive compounds. Additionally, the compound's specific stereochemistry and functional groups may contribute to its pharmacological properties, making it a subject of interest in drug design and development. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of the fluorine atom, which can impart unique toxicological properties.
Formula:C17H14FNO3
InChI:InChI=1S/C17H14FNO3/c18-13-6-3-5-11(8-13)15(9-16(20)21)19-10-12-4-1-2-7-14(12)17(19)22/h1-8,15H,9-10H2,(H,20,21)
InChI key:InChIKey=UYKHBEQSZJBUBT-UHFFFAOYSA-N
SMILES:C(CC(O)=O)(N1CC=2C(C1=O)=CC=CC2)C3=CC(F)=CC=C3
Synonyms:
  • 2H-Isoindole-2-propanoic acid, β-(3-fluorophenyl)-1,3-dihydro-1-oxo-
  • β-(3-Fluorophenyl)-1,3-dihydro-1-oxo-2H-isoindole-2-propanoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.