CAS 4786-72-5

5-bromo-2-chloro-4,6-dimethylpyrimidine

Description:

5-Bromo-2-chloro-4,6-dimethylpyrimidine is a heterocyclic organic compound belonging to the pyrimidine family, characterized by a six-membered ring containing two nitrogen atoms at positions 1 and 3. This compound features multiple substituents, including a bromine atom at the 5-position and a chlorine atom at the 2-position, along with two methyl groups at the 4 and 6 positions. These substitutions contribute to its unique chemical properties, influencing its reactivity and potential applications in various fields, such as pharmaceuticals and agrochemicals. The presence of halogens (bromine and chlorine) typically enhances the compound's reactivity, making it useful in nucleophilic substitution reactions. Additionally, the methyl groups can affect the compound's solubility and stability. 5-Bromo-2-chloro-4,6-dimethylpyrimidine is often utilized as an intermediate in the synthesis of more complex organic molecules, particularly in the development of biologically active compounds. Its specific characteristics, such as melting point, boiling point, and solubility, can vary based on environmental conditions and the presence of other substances.

Formula: C₆H₆BrClN₂

InChI: InChI=1/C6H6BrClN2/c1-3-5(7)4(2)10-6(8)9-3/h1-2H3

SMILES: Cc1c(c(C)nc(Cl)n1)Br

Synonyms:

• Pyrimidine, 5-Bromo-2-Chloro-4,6-Dimethyl-

5-Bromo-2-chloro-4,6-dimethylpyrimidine

CAS: 4786-72-5

Formula: C₆H₆BrClN₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 221.4822

Ref: IN-DA003MGR

5-Bromo-2-chloro-4,6-dimethylpyrimidine

CAS: 4786-72-5

5-Bromo-2-chloro-4,6-dimethylpyrimidine

Purity: 98%

Molecular weight: 221.48g/mol

Ref: 54-OR75484

5-Bromo-2-chloro-4,6-dimethylpyrimidine

CAS: 4786-72-5

Formula: C₆H₆BrClN₂

Purity: 97%

Color and Shape: Solid, Yellow powder

Molecular weight: 221.48

Ref: 10-F077926