CAS 4786-76-9

4-methoxy-7H-pyrrolo[2,3-d]pyrimidine

Description:

4-Methoxy-7H-pyrrolo[2,3-d]pyrimidine is a heterocyclic organic compound characterized by its fused pyrrole and pyrimidine rings, which contribute to its unique chemical properties. The presence of a methoxy group (-OCH3) at the 4-position enhances its solubility and reactivity, making it of interest in various chemical applications, including medicinal chemistry. This compound typically exhibits a planar structure, which can facilitate interactions with biological targets, potentially influencing its pharmacological activity. Its molecular framework allows for the possibility of hydrogen bonding and π-π stacking interactions, which are important in biological systems. Additionally, the compound may exhibit fluorescence properties, making it useful in certain analytical applications. The CAS number 4786-76-9 serves as a unique identifier for this substance, aiding in its identification in chemical databases and literature. Overall, 4-methoxy-7H-pyrrolo[2,3-d]pyrimidine is a compound of interest for its structural features and potential applications in drug development and research.

Formula: C₇H₇N₃O

InChI: InChI=1/C7H7N3O/c1-11-7-5-2-3-8-6(5)9-4-10-7/h2-4H,1H3,(H,8,9,10)

SMILES: COc1c2cc[nH]c2ncn1

Synonyms:

• 1H-Pyrrolo[2,3-D]Pyrimidine, 4-Methoxy-

1H-Pyrrolo[2,3-d]pyrimidine, 4-methoxy- (8CI,9CI)

CAS: 4786-76-9

Formula: C₇H₇N₃O

Purity: 97%

Color and Shape: Solid

Molecular weight: 149.1500

Ref: IN-DA00DJSM

4-Methoxy-7h-pyrrolo[2,3-d]pyrimidine

CAS: 4786-76-9

4-Methoxy-7h-pyrrolo[2,3-d]pyrimidine

Purity: 98%

Color and Shape: Solid

Molecular weight: 149.15g/mol

Ref: 54-OR924446

4-Methoxy-7H-pyrrolo[2,3-d]pyrimidine

CAS: 4786-76-9

Formula: C₇H₇N₃O

Purity: 98%

Color and Shape: Liquid, No data available.

Molecular weight: 149.153

Ref: 10-F459339