CAS 478834-25-2

4-chloro-1H-indazol-5-ol

Description:

4-Chloro-1H-indazol-5-ol is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a chlorine atom at the 4-position and a hydroxyl group (-OH) at the 5-position contributes to its unique reactivity and properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the hydroxyl group, while its aromatic nature can influence its interactions with other molecules. 4-Chloro-1H-indazol-5-ol may be of interest in medicinal chemistry and research due to its potential biological activity, including possible roles in drug development or as a biochemical probe. Its specific characteristics, such as melting point, boiling point, and spectral data, would be determined through experimental methods and can vary based on purity and environmental conditions. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information.

Formula: C₇H₅ClN₂O

InChI: InChI=1/C7H5ClN2O/c8-7-4-3-9-10-5(4)1-2-6(7)11/h1-3,11H,(H,9,10)

SMILES: c1cc(c(c2c[nH]nc12)Cl)O

Synonyms:

• 4-Chloro-4-hydroxy-1H-indazole
• 1H-Indazol-5-ol, 4-chloro-
• 4-Chloro-1H-indazol-5-ol

1H-Indazol-5-ol, 4-chloro-

CAS: 478834-25-2

Formula: C₇H₅ClN₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 168.5804

Ref: IN-DA00DKEO

4-Chloro-1H-indazol-5-ol

CAS: 478834-25-2

4-Chloro-1H-indazol-5-ol

Purity: 95%

Molecular weight: 168.58g/mol

Ref: 54-OR77652

4-Chloro-1H-indazol-5-ol

CAS: 478834-25-2

Formula: C₇H₅ClN₂O

Purity: 95%

Color and Shape: No data available.

Molecular weight: 168.58

Ref: 10-F337296

4-CHLORO-1H-INDAZOL-5-OL

CAS: 478834-25-2

Purity: 95%

Molecular weight: 168.5800018

Ref: 10-F801962