CymitQuimica logo

CAS 478841-10-0

:

1H-Azepine-1-carboxylic acid, hexahydro-3-hydroxy-, 1,1-dimethylethylester

Description:
1H-Azepine-1-carboxylic acid, hexahydro-3-hydroxy-, 1,1-dimethylethylester, identified by CAS number 478841-10-0, is a chemical compound characterized by its unique structure, which includes a seven-membered azepine ring. This compound features a carboxylic acid functional group and an ester moiety, indicating it can participate in various chemical reactions typical of both acids and esters. The presence of a hydroxy group suggests potential for hydrogen bonding, which can influence its solubility and reactivity. The tert-butyl ester group (1,1-dimethylethyl) enhances the lipophilicity of the molecule, potentially affecting its biological activity and interaction with other substances. This compound may be of interest in medicinal chemistry and organic synthesis due to its structural features, which could lead to the development of pharmaceuticals or agrochemicals. However, specific physical properties such as melting point, boiling point, and solubility would need to be determined experimentally or sourced from reliable databases for comprehensive characterization.
Formula:C11H21NO3
InChI:InChI=1S/C11H21NO3/c1-11(2,3)15-10(14)12-7-5-4-6-9(13)8-12/h9,13H,4-8H2,1-3H3
InChI key:YLXNIRRSRXUTCK-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCCCC(C1)O
Found 5 products.