CAS 478954-83-5
:Dibenzyl (~2~H_4_)benzene-1,2-dicarboxylate
Description:
Dibenzyl benzene-1,2-dicarboxylate, with the CAS number 478954-83-5, is an organic compound characterized by its structure, which includes two benzyl groups and two carboxylate functional groups attached to a benzene ring. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its specific form and purity. It is known for its potential applications in organic synthesis and as an intermediate in the production of various chemical products. The presence of the carboxylate groups contributes to its reactivity, allowing it to participate in various chemical reactions, such as esterification and acylation. Additionally, dibenzyl benzene-1,2-dicarboxylate may exhibit interesting physical properties, including solubility in organic solvents and moderate thermal stability. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential hazards associated with its use.
Formula:C22H14D4O4
InChI:InChI=1/C22H18O4/c23-21(25-15-17-9-3-1-4-10-17)19-13-7-8-14-20(19)22(24)26-16-18-11-5-2-6-12-18/h1-14H,15-16H2/i7D,8D,13D,14D
SMILES:c1ccc(cc1)COC(=O)c1c(c(c(c(c1C(=O)OCc1ccccc1)[2H])[2H])[2H])[2H]
Synonyms:- 1,2-Benzene-d4-dicarboxylic acid, bis(phenylmethyl) ester
- 478954-83-5
- Bis(phenylmethyl) 1,2-benzene-d4-dicarboxylate
- Dibenzyl (2H4)benzene-1,2-dicarboxylate
- Dibenzyl phthalate-3,4,5,6-d4
- R1OVR BVO1R & & Deutero-D4 (phthalate ring)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
mono-Benzyl Phthalate-3,4,5,6-d4
CAS:Formula:HOOCC6D4COOCH2C6H5Purity:99 atom % DColor and Shape:White SolidMolecular weight:260.09867Monobenzyl Phthalate-d4
CAS:Controlled ProductApplications Labelled Phthalate metabolite, which has been shown to influence preterm deliveries.
References Mineno, T., et al.: Chem. Pharm. Bull., 57, 1167 (2009), Aylward, L., et al.: Reg. Toxicol. Pharmacol., 55, 259 (2009), Engel, S., et al.: NeuroToxicol., 30, 522 (2009),Formula:C152H4H8O4Color and Shape:White To Off-WhiteMolecular weight:260.28

