CymitQuimica logo

CAS 478963-79-0

:

1-(propan-2-yl)-4-[4-(propan-2-yl)phenyl]-6-(prop-2-yn-1-yloxy)quinazolin-2(1H)-one

Description:
1-(Propan-2-yl)-4-[4-(propan-2-yl)phenyl]-6-(prop-2-yn-1-yloxy)quinazolin-2(1H)-one, with the CAS number 478963-79-0, is a synthetic organic compound characterized by its complex structure, which includes a quinazolinone core. This compound features multiple functional groups, including isopropyl and propargyl moieties, contributing to its potential biological activity. Quinazolinones are known for their diverse pharmacological properties, including anti-cancer, anti-inflammatory, and antimicrobial effects. The presence of the isopropyl groups may enhance lipophilicity, potentially influencing its absorption and distribution in biological systems. The propargyl ether functionality can also provide unique reactivity, making it a candidate for further chemical modifications. As with many synthetic compounds, its stability, solubility, and reactivity can vary based on environmental conditions. Overall, this compound represents a class of molecules that may be of interest in medicinal chemistry and drug development, warranting further investigation into its biological properties and potential applications.
Formula:C23H24N2O2
InChI:InChI=1/C23H24N2O2/c1-6-13-27-19-11-12-21-20(14-19)22(24-23(26)25(21)16(4)5)18-9-7-17(8-10-18)15(2)3/h1,7-12,14-16H,13H2,2-5H3
SMILES:C#CCOc1ccc2c(c1)c(c1ccc(cc1)C(C)C)nc(=O)n2C(C)C
Synonyms:
  • 1-Isopropyl-4-(4-isopropylphenyl)-6-(prop-2-in-1-yloxy)chinazolin-2(1H)-on
  • 1-isopropyl-4-(4-isopropylphenyl)-6-(prop-2-yn-1-yloxy)quinazolin-2(1H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.