CAS 479-30-1
:5-Hydroxy-6-methyl-3,4-pyridinedicarboxylic acid
Description:
5-Hydroxy-6-methyl-3,4-pyridinedicarboxylic acid, also known as 6-methyl-2,3-pyridinedicarboxylic acid, is an organic compound characterized by its pyridine ring structure with two carboxylic acid functional groups and a hydroxyl group. This compound typically appears as a crystalline solid and is soluble in water due to the presence of polar functional groups. It exhibits acidic properties, primarily due to the carboxylic acid groups, which can donate protons in solution. The hydroxyl group contributes to its potential as a chelating agent, allowing it to form complexes with metal ions. This compound is of interest in various fields, including pharmaceuticals and biochemistry, where it may play a role in metabolic pathways or serve as a precursor for the synthesis of other biologically active molecules. Its structural features also suggest potential antioxidant properties, making it a subject of research in health-related applications. Overall, 5-Hydroxy-6-methyl-3,4-pyridinedicarboxylic acid is a versatile compound with significant chemical and biological relevance.
Formula:C8H7NO5
InChI:InChI=1S/C8H7NO5/c1-3-6(10)5(8(13)14)4(2-9-3)7(11)12/h2,10H,1H3,(H,11,12)(H,13,14)
InChI key:InChIKey=LVJJEIJOKPHQOU-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(C(O)=O)=CN=C(C)C1O
Synonyms:- 3,4-Pyridinedicarboxylic acid, 5-hydroxy-6-methyl-
- 5-Hydroxy-6-methyl-3,4-pyridinedicarboxylic acid
- Ichiba acid
- 3-Hydroxy-2-methylpyridine-4,5-dicarboxylic acid
- 3-Hydroxy-2-methyl-4,5-pyridinedicarboxylic acid
- 6-Methyl-5-hydroxypyridine-3,4-dicarboxylic acid
- Pyridoxine Impurity 47
- LVJJEIJOKPHQOU-UHFFFAOYSA-N
- 5-Hydroxy-6-methylpyridine-3,4-dicarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
5-Hydroxy-6-methyl-3,4-pyridinedicarboxylic Acid
CAS:Controlled Product<p>Applications 5-Hydroxy-6-methyl-3,4-pyridinedicarboxylic Acid is used in studies to identify 4-pyridoxic acid dehydrogenase gene in pyridoxine catabolism of Mesorhizobium loti MAFF303099.<br>References Mukherjee, T., et al.: Bioorg. Chem., 35, 458 (2007)<br></p>Formula:C8H7NO5Color and Shape:Off-WhiteMolecular weight:197.14

