CAS 479-33-4: 2,3,4,5-Tetraphenyl-2,4-cyclopentadien-1-one
Description:2,3,4,5-Tetraphenyl-2,4-cyclopentadien-1-one, with the CAS number 479-33-4, is an organic compound characterized by its unique structure, which features a cyclopentadienone core substituted with four phenyl groups. This compound exhibits notable stability due to the delocalization of electrons across the conjugated system formed by the cyclopentadienone and the phenyl rings. It typically appears as a solid at room temperature and is known for its vibrant color, which can vary depending on the specific conditions and purity. The presence of multiple phenyl groups enhances its solubility in organic solvents and contributes to its potential applications in organic synthesis and materials science. Additionally, 2,3,4,5-tetraphenyl-2,4-cyclopentadien-1-one can participate in various chemical reactions, including oxidation and reduction processes, making it a valuable compound for research in organic chemistry. Its properties, such as melting point, boiling point, and spectral characteristics, can be influenced by factors like solvent interactions and the presence of substituents.
Formula:C29H20O
InChI:InChI=1S/C29H20O/c30-29-27(23-17-9-3-10-18-23)25(21-13-5-1-6-14-21)26(22-15-7-2-8-16-22)28(29)24-19-11-4-12-20-24/h1-20H
InChI key:InChIKey=PLGPSDNOLCVGSS-UHFFFAOYSA-N
SMILES:O=C1C(C=2C=CC=CC2)=C(C=3C=CC=CC3)C(C=4C=CC=CC4)=C1C=5C=CC=CC5
- Synonyms:
- 2,3,4,5-Tetraphenyl-2,4-cyclopentadien-1-one
- 2,3,4,5-Tetraphenylcyclopenta-2,4-Dien-1-One
- 2,3,4,5-Tetraphenylcyclopenta-2,4-Dienone
- 2,3,4,5-Tetraphenylcyclopentadienone
- 2,4-Cyclopentadien-1-one, 2,3,4,5-tetraphenyl-
- Cyclone
- Cyclone (compound)
- Cyclopentadienone, tetraphenyl-
- NSC 2060
- NSC 220314
- See more synonyms
- NSC 243761
- TC
- Tetracyclon
- Tetracyclone
- Tetraphenyl-2,4-cyclopentadien-1-one
- Tpcd
