CAS 479-66-3
:Fulvic acid
Description:
Fulvic acid is a complex organic acid that is a component of humic substances, which are derived from the decomposition of organic matter, particularly in soil and aquatic environments. It is characterized by its low molecular weight and high solubility in water across a wide range of pH levels. Fulvic acid is typically yellow to brown in color and has a strong ability to chelate metal ions, which enhances nutrient availability in soils and promotes plant growth. Its structure is composed of various functional groups, including carboxyl, phenolic, and hydroxyl groups, contributing to its reactivity and interaction with other substances. Fulvic acid is known for its antioxidant properties and potential health benefits, including anti-inflammatory effects. It is widely used in agriculture as a soil conditioner and in various industries, including pharmaceuticals and cosmetics, due to its bioactive properties. Additionally, fulvic acid plays a significant role in environmental processes, such as nutrient cycling and pollutant degradation.
Formula:C14H12O8
InChI:InChI=1/C14H12O8/c1-14(20)3-8-5(4-21-14)11(16)9-7(22-8)2-6(15)12(17)10(9)13(18)19/h2,15,17,20H,3-4H2,1H3,(H,18,19)
InChI key:InChIKey=FCYKAQOGGFGCMD-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C2C(OC3=C(C2=O)COC(C)(O)C3)=CC(O)=C1O
Synonyms:- 1H,10H-Pyrano[4,3-b][1]benzopyran-9-carboxylic acid, 3,4-dihydro-3,7,8-trihydroxy-3-methyl-10-oxo-
- 1H,3H-Pyrano[4,3-b][1]benzopyran-9-carboxylic acid, 4,10-dihydro-3,7,8-trihydroxy-3-methyl-10-oxo-
- 3,7,8-Trihydroxy-3-methyl-10-oxo-1,4-dihydropyrano[4,3-b]chromene-9-carboxylic acid
- 3,7,8-trihydroxy-3-methyl-10-oxo-4,10-dihydro-1H,3H-pyrano[4,3-b]chromene-9-carboxylic acid
- 4,10-Dihydro-3,7,8-trihydroxy-3-methyl-10-oxo-1H,3H-pyrano[4,3-b][1]benzopyran-9-carboxylic acid
- Fulvic acid
- FULVIC ACID PURITY 95%
- 1H,3H-Pyrano4,3-b1benzopyran-9-carboxylic acid, 4,10-dihydro-3,7,8-trihydroxy-3-methyl-10-oxo-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1H,3H-Pyrano[4,3-b][1]benzopyran-9-carboxylic acid,4,10-dihydro-3,7,8-trihydroxy-3-methyl-10-oxo-
CAS:Formula:C14H12O8Purity:90%Color and Shape:SolidMolecular weight:308.2403Fulvic acid
CAS:Formula:C14H12O8Purity:≥ 95.0%Color and Shape:Pale yellow to yellow powder or solidMolecular weight:308.2Fulvic Acid
CAS:Fulvic Acid is a natural product of humus produced by microorganisms in soil, sediment or aquatic environments.
Formula:C14H12O8Color and Shape:Yellow Crystalline SolidMolecular weight:308.24Ref: TM-T38108
1g1,890.00€1mg96.00€5mg130.00€10mg183.00€25mg306.00€50mg455.00€100mg652.00€500mg1,406.00€Fulvic acid
CAS:Fulvic acid is a natural organic compound that has been used in clinical and biological properties. It is a fluorescent molecule with a high quantum yield, which makes it an ideal candidate for use as a fluorescence probe. Fulvic acid has been shown to form stable complexes with malonic acid, which may be due to the strong hydrogen bonding interactions between these two molecules. The fluorescence emission spectrum of fulvic acid is sensitive to the pH of the reaction solution, and it can be used as a thermodynamic data indicator. Fulvic acid also has low toxicity, which makes it suitable for use in laboratory studies.Formula:C14H12O8Purity:Min. 90%Color and Shape:PowderMolecular weight:308.24 g/mol





