CAS 479-79-8
:11H-benzo[a]fluoren-11-one
Description:
11H-benzo[a]fluoren-11-one, with the CAS number 479-79-8, is an organic compound that belongs to the class of polycyclic aromatic ketones. It features a fused ring system that includes a benzene ring and a fluorenone structure, characterized by a carbonyl group (C=O) at the 11-position of the fluorenone framework. This compound is typically a solid at room temperature and is known for its aromatic properties, which contribute to its stability and potential applications in organic synthesis and materials science. It exhibits fluorescence, making it useful in various photonic applications. The compound is generally insoluble in water but soluble in organic solvents such as ethanol and acetone. Its chemical behavior is influenced by the presence of the carbonyl group, which can participate in various reactions, including nucleophilic additions. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks upon exposure. Overall, 11H-benzo[a]fluoren-11-one is a significant compound in organic chemistry with potential applications in research and industry.
Formula:C17H10O
InChI:InChI=1/C17H10O/c18-17-15-8-4-3-7-13(15)14-10-9-11-5-1-2-6-12(11)16(14)17/h1-10H
SMILES:c1ccc2c(c1)ccc1c3ccccc3C(=O)c21
Synonyms:- 11-Benzo[A]Fluorenone
- 11H-Benzo[a]fluoren-11-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
11H-Benzo[a]fluoren-11-one
CAS:Formula:C17H10OPurity:>98.0%(GC)Color and Shape:Light yellow to Amber to Dark green powder to crystalMolecular weight:230.2711H-Benzo[a]fluoren-11-one
CAS:Formula:C17H10OPurity:98%Color and Shape:SolidMolecular weight:230.2607Benzo[a]fluoren-11-one
CAS:Controlled ProductApplications Benzo[a]fluoren-11-one is a polycyclic aromatic hydrocarbon that has potential carcinogenic properties. It is a common organic substance found in aerosols, atmospheric air and gasoline exhausts.
References Bekki, K., et al.: J. Health Sci., 55, 601 (2009); Moeller, M., et al.: Mutat. Res. Gen. Toxicol. Test., 157, 149 (1985); Simoneit, B., et al.: Atmos. Env. A. Gen. Topic., 25A, 2111 (1991); Yu, M. & Hites, R.: Anal. Chem., 53, 951 (1981)Formula:C17H10OColor and Shape:OrangeMolecular weight:230.26



