CAS 4790-04-9

5-benzyloxy-6-methoxyindole crystalline

Description:

5-Benzyloxy-6-methoxyindole is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This particular compound features a benzyloxy group at the 5-position and a methoxy group at the 6-position of the indole ring, contributing to its unique chemical properties. It is typically a crystalline solid, which indicates a well-ordered molecular arrangement. The presence of the benzyloxy and methoxy substituents can influence its solubility, reactivity, and potential biological activity. Compounds of this nature may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. Additionally, the compound's stability, melting point, and solubility in various solvents can vary based on its crystalline form and purity. As with many indole derivatives, it may also participate in various chemical reactions, such as electrophilic substitutions, due to the electron-rich nature of the indole nitrogen. Overall, 5-benzyloxy-6-methoxyindole is a notable compound in organic synthesis and pharmaceutical research.

Formula: C₁₆H₁₅NO₂

InChI: InChI=1/C16H15NO2/c1-18-15-10-14-13(7-8-17-14)9-16(15)19-11-12-5-3-2-4-6-12/h2-10,17H,11H2,1H3

SMILES: COc1cc2c(cc[nH]2)cc1OCc1ccccc1

Synonyms:

• 5-(benzyloxy)-6-methoxy-1H-indole

5-(Benzyloxy)-6-methoxy-1H-indole

CAS: 4790-04-9

Formula: C₁₆H₁₅NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 253.2958

Ref: IN-DA00DE53

5-Benzyloxy-6-methoxyindole

Controlled Product

CAS: 4790-04-9

Applications 5-Benzyloxy-6-methoxyindole (cas# 4790-04-9) is a compound useful in organic synthesis.
References McBride, C., et al.: Bioorg. Med. Chem. Lett., 16, 3789 (2006), Frost, J., et al.: J. Med. Chem., 51, 1904 (2008),

Formula: C₁₆H₁₅NO₂

Color and Shape: Neat

Molecular weight: 253.30

Ref: TR-B285990