CymitQuimica logo

CAS 4790-79-8

:

7-Methoxybenzofuran-2-carboxylic acid

Description:
7-Methoxybenzofuran-2-carboxylic acid is an organic compound characterized by its benzofuran structure, which consists of a fused benzene and furan ring. The presence of a methoxy group (-OCH3) at the 7-position and a carboxylic acid group (-COOH) at the 2-position contributes to its chemical reactivity and solubility properties. This compound typically exhibits moderate polarity due to the functional groups, making it soluble in polar solvents like alcohols and water to some extent. It may participate in various chemical reactions, including esterification and acylation, due to the reactive carboxylic acid group. Additionally, the compound may exhibit biological activity, which has been of interest in medicinal chemistry. Its structural features suggest potential applications in pharmaceuticals or as a precursor in organic synthesis. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.
Formula:C10H7O4
InChI:InChI=1/C10H8O4/c1-13-7-4-2-3-6-5-8(10(11)12)14-9(6)7/h2-5H,1H3,(H,11,12)/p-1
InChI key:UOCNTRAAJNWDND-UHFFFAOYSA-N
SMILES:COC1=CC=CC2=C1OC(=C2)C(=O)O
Synonyms:
  • 7-Methoxy-1-benzofuran-2-carboxylic acid
  • 7-Methoxy-1-Benzofuran-2-Carboxylate
Found 3 products.