CAS 479077-76-4
:1-[4-(naphtho[2,3-b]furan-4-ylamino)phenyl]ethanone
Description:
1-[4-(Naphtho[2,3-b]furan-4-ylamino)phenyl]ethanone, with the CAS number 479077-76-4, is an organic compound characterized by its complex structure that includes a naphtho[2,3-b]furan moiety linked to an ethanone group through an aniline derivative. This compound typically exhibits properties associated with aromatic systems, such as stability and potential for π-π stacking interactions. It may display fluorescence due to the presence of conjugated systems, making it of interest in materials science and organic electronics. The presence of the naphthalene and furan rings suggests potential biological activity, which could be explored in medicinal chemistry. Additionally, the compound's solubility and reactivity can be influenced by the functional groups present, affecting its applications in various chemical reactions or as a precursor in synthetic pathways. Overall, this compound represents a class of organic molecules that may have significant implications in both industrial and pharmaceutical contexts.
Formula:C20H15NO2
InChI:InChI=1/C20H15NO2/c1-13(22)14-6-8-16(9-7-14)21-20-17-5-3-2-4-15(17)12-19-18(20)10-11-23-19/h2-12,21H,1H3
SMILES:CC(=O)c1ccc(cc1)Nc1c2ccccc2cc2c1cco2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
CIL-102
CAS:<p>CIL-102 is an apoptosis inducer that functions as an MMP-2/MMP-9 inhibitor, effectively reducing both the protein expression and mRNA levels of MMP-2/MMP-9. CIL-102 also demonstrates anticancer activity.</p>Formula:C19H14N2O2Color and Shape:SolidMolecular weight:302.327

